C15H20FN3O2 — CID 72872160
N-(2-fluoro-4-methoxyphenyl)-4-prop-2-enylpiperazine-1-carboxamide (PubChem CID 72872160) has the molecular formula C15H20FN3O2 and a molecular weight of 293.34 g/mol. Its IUPAC name is N-(2-fluoro-4-methoxyphenyl)-4-prop-2-enylpiperazine-1-carboxamide.
| Compound Name | N-(2-fluoro-4-methoxyphenyl)-4-prop-2-enylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 72872160 |
| Molecular Formula | C15H20FN3O2 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | N-(2-fluoro-4-methoxyphenyl)-4-prop-2-enylpiperazine-1-carboxamide |
| SMILES | C=CCN1CCN(C(=O)Nc2ccc(OC)cc2F)CC1 |
| InChI | InChI=1S/C15H20FN3O2/c1-3-6-18-7-9-19(10-8-18)15(20)17-14-5-4-12(21-2)11-13(14)16/h3-5,11H,1,6-10H2,2H3,(H,17,20) |
| InChIKey | BBPNXFIORKXCIT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|