C19H26N4O3 — CID 72876997
(2S)-2-[(4-ethoxy-3-pyrrol-1-ylphenyl)carbamoylamino]-4-methylpentanamide (PubChem CID 72876997) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is (2S)-2-[(4-ethoxy-3-pyrrol-1-ylphenyl)carbamoylamino]-4-methylpentanamide.
| Compound Name | (2S)-2-[(4-ethoxy-3-pyrrol-1-ylphenyl)carbamoylamino]-4-methylpentanamide |
|---|---|
| PubChem CID | 72876997 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | (2S)-2-[(4-ethoxy-3-pyrrol-1-ylphenyl)carbamoylamino]-4-methylpentanamide |
| SMILES | CCOc1ccc(NC(=O)N[C@@H](CC(C)C)C(N)=O)cc1-n1cccc1 |
| InChI | InChI=1S/C19H26N4O3/c1-4-26-17-8-7-14(12-16(17)23-9-5-6-10-23)21-19(25)22-15(18(20)24)11-13(2)3/h5-10,12-13,15H,4,11H2,1-3H3,(H2,20,24)(H2,21,22,25)/t15-/m0/s1 |
| InChIKey | XRNITEFQFGNGJC-HNNXBMFYSA-N |
| XLogP | 2.90 |
| TPSA | 98.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |