C16H18ClN5O — CID 72877783
2-tert-butyl-N-(2-chloro-3-pyridinyl)-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxamide (PubChem CID 72877783) has the molecular formula C16H18ClN5O and a molecular weight of 331.81 g/mol. Its IUPAC name is 2-tert-butyl-N-(2-chloro-3-pyridinyl)-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxamide.
| Compound Name | 2-tert-butyl-N-(2-chloro-3-pyridinyl)-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 72877783 |
| Molecular Formula | C16H18ClN5O |
| Molecular Weight | 331.81 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 2-tert-butyl-N-(2-chloro-3-pyridinyl)-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxamide |
| SMILES | CC(C)(C)c1ncc2c(n1)CN(C(=O)Nc1cccnc1Cl)C2 |
| InChI | InChI=1S/C16H18ClN5O/c1-16(2,3)14-19-7-10-8-22(9-12(10)20-14)15(23)21-11-5-4-6-18-13(11)17/h4-7H,8-9H2,1-3H3,(H,21,23) |
| InChIKey | CGNAZULLWDFNHL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.81 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|