C19H15ClN2O4 — CID 72877931
2-[[5-(2-chlorophenyl)furan-2-carbonyl]-methylamino]-2-pyridin-3-ylacetic acid (PubChem CID 72877931) has the molecular formula C19H15ClN2O4 and a molecular weight of 370.79 g/mol. Its IUPAC name is 2-[[5-(2-chlorophenyl)furan-2-carbonyl]-methylamino]-2-pyridin-3-ylacetic acid.
| Compound Name | 2-[[5-(2-chlorophenyl)furan-2-carbonyl]-methylamino]-2-pyridin-3-ylacetic acid |
|---|---|
| PubChem CID | 72877931 |
| Molecular Formula | C19H15ClN2O4 |
| Molecular Weight | 370.79 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 2-[[5-(2-chlorophenyl)furan-2-carbonyl]-methylamino]-2-pyridin-3-ylacetic acid |
| SMILES | CN(C(=O)c1ccc(-c2ccccc2Cl)o1)C(C(=O)O)c1cccnc1 |
| InChI | InChI=1S/C19H15ClN2O4/c1-22(17(19(24)25)12-5-4-10-21-11-12)18(23)16-9-8-15(26-16)13-6-2-3-7-14(13)20/h2-11,17H,1H3,(H,24,25) |
| InChIKey | RFSISWUAUVBQHA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.79 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |