C20H22F2N2O2 — CID 72890028
1-(4-benzyl-6-hydroxy-1,4-diazepan-1-yl)-2-(2,4-difluorophenyl)ethanone (PubChem CID 72890028) has the molecular formula C20H22F2N2O2 and a molecular weight of 360.40 g/mol. Its IUPAC name is 1-(4-benzyl-6-hydroxy-1,4-diazepan-1-yl)-2-(2,4-difluorophenyl)ethanone.
| Compound Name | 1-(4-benzyl-6-hydroxy-1,4-diazepan-1-yl)-2-(2,4-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 72890028 |
| Molecular Formula | C20H22F2N2O2 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 1-(4-benzyl-6-hydroxy-1,4-diazepan-1-yl)-2-(2,4-difluorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(F)cc1F)N1CCN(Cc2ccccc2)CC(O)C1 |
| InChI | InChI=1S/C20H22F2N2O2/c21-17-7-6-16(19(22)11-17)10-20(26)24-9-8-23(13-18(25)14-24)12-15-4-2-1-3-5-15/h1-7,11,18,25H,8-10,12-14H2 |
| InChIKey | FVGJEILTGKHYJW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |