C21H30N4O3 — CID 72891734
1-methyl-3-[4-(oxan-2-ylmethoxy)phenyl]-1-[(3-propyl-1H-pyrazol-5-yl)methyl]urea (PubChem CID 72891734) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is 1-methyl-3-[4-(oxan-2-ylmethoxy)phenyl]-1-[(3-propyl-1H-pyrazol-5-yl)methyl]urea.
| Compound Name | 1-methyl-3-[4-(oxan-2-ylmethoxy)phenyl]-1-[(3-propyl-1H-pyrazol-5-yl)methyl]urea |
|---|---|
| PubChem CID | 72891734 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 1-methyl-3-[4-(oxan-2-ylmethoxy)phenyl]-1-[(3-propyl-1H-pyrazol-5-yl)methyl]urea |
| SMILES | CCCc1cc(CN(C)C(=O)Nc2ccc(OCC3CCCCO3)cc2)[nH]n1 |
| InChI | InChI=1S/C21H30N4O3/c1-3-6-17-13-18(24-23-17)14-25(2)21(26)22-16-8-10-19(11-9-16)28-15-20-7-4-5-12-27-20/h8-11,13,20H,3-7,12,14-15H2,1-2H3,(H,22,26)(H,23,24) |
| InChIKey | BWMNAAKQDYMJHY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |