C14H22N4O3S — CID 72893132
(4aR,8aR)-2-(6-methylpyridazin-3-yl)-7-methylsulfonyl-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-4a-ol (PubChem CID 72893132) has the molecular formula C14H22N4O3S and a molecular weight of 326.42 g/mol. Its IUPAC name is (4aR,8aR)-2-(6-methylpyridazin-3-yl)-7-methylsulfonyl-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-4a-ol.
| Compound Name | (4aR,8aR)-2-(6-methylpyridazin-3-yl)-7-methylsulfonyl-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-4a-ol |
|---|---|
| PubChem CID | 72893132 |
| Molecular Formula | C14H22N4O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | (4aR,8aR)-2-(6-methylpyridazin-3-yl)-7-methylsulfonyl-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-4a-ol |
| SMILES | Cc1ccc(N2CC[C@@]3(O)CCN(S(C)(=O)=O)C[C@H]3C2)nn1 |
| InChI | InChI=1S/C14H22N4O3S/c1-11-3-4-13(16-15-11)17-7-5-14(19)6-8-18(22(2,20)21)10-12(14)9-17/h3-4,12,19H,5-10H2,1-2H3/t12-,14-/m1/s1 |
| InChIKey | RRCCSBNNYRZNDP-TZMCWYRMSA-N |
| XLogP | 0.01 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |