C19H27N3O4 — CID 72894334
(2S,4R)-N,N-diethyl-4-(furan-3-carbonylamino)-1-[(E)-pent-3-enoyl]pyrrolidine-2-carboxamide (PubChem CID 72894334) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is (2S,4R)-N,N-diethyl-4-(furan-3-carbonylamino)-1-[(E)-pent-3-enoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N,N-diethyl-4-(furan-3-carbonylamino)-1-[(E)-pent-3-enoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 72894334 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | (2S,4R)-N,N-diethyl-4-(furan-3-carbonylamino)-1-[(E)-pent-3-enoyl]pyrrolidine-2-carboxamide |
| SMILES | C/C=C/CC(=O)N1C[C@H](NC(=O)c2ccoc2)C[C@H]1C(=O)N(CC)CC |
| InChI | InChI=1S/C19H27N3O4/c1-4-7-8-17(23)22-12-15(20-18(24)14-9-10-26-13-14)11-16(22)19(25)21(5-2)6-3/h4,7,9-10,13,15-16H,5-6,8,11-12H2,1-3H3,(H,20,24)/b7-4+/t15-,16+/m1/s1 |
| InChIKey | FXBZQPOWHPOGTN-YFWHOBGESA-N |
| XLogP | 1.81 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|