C20H33N5O2 — CID 91940113
(2S,4S)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-N,N-diethyl-4-(pent-3-enoylamino)pyrrolidine-2-carboxamide (PubChem CID 91940113) has the molecular formula C20H33N5O2 and a molecular weight of 375.52 g/mol. Its IUPAC name is (2S,4S)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-N,N-diethyl-4-(pent-3-enoylamino)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-N,N-diethyl-4-(pent-3-enoylamino)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 91940113 |
| Molecular Formula | C20H33N5O2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | (2S,4S)-1-[(1,3-dimethylpyrazol-4-yl)methyl]-N,N-diethyl-4-(pent-3-enoylamino)pyrrolidine-2-carboxamide |
| SMILES | CC=CCC(=O)N[C@H]1C[C@@H](C(=O)N(CC)CC)N(Cc2cn(C)nc2C)C1 |
| InChI | InChI=1S/C20H33N5O2/c1-6-9-10-19(26)21-17-11-18(20(27)24(7-2)8-3)25(14-17)13-16-12-23(5)22-15(16)4/h6,9,12,17-18H,7-8,10-11,13-14H2,1-5H3,(H,21,26)/t17-,18-/m0/s1 |
| InChIKey | ZWONGCZXHPYJKZ-ROUUACIJSA-N |
| XLogP | 1.62 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|