C17H25N3O3 — CID 72895539
1-(6-cyclopropylpyrimidin-4-yl)-3-(3-methoxypropyl)piperidine-3-carboxylic acid (PubChem CID 72895539) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is 1-(6-cyclopropylpyrimidin-4-yl)-3-(3-methoxypropyl)piperidine-3-carboxylic acid.
| Compound Name | 1-(6-cyclopropylpyrimidin-4-yl)-3-(3-methoxypropyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 72895539 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 1-(6-cyclopropylpyrimidin-4-yl)-3-(3-methoxypropyl)piperidine-3-carboxylic acid |
| SMILES | COCCCC1(C(=O)O)CCCN(c2cc(C3CC3)ncn2)C1 |
| InChI | InChI=1S/C17H25N3O3/c1-23-9-3-7-17(16(21)22)6-2-8-20(11-17)15-10-14(13-4-5-13)18-12-19-15/h10,12-13H,2-9,11H2,1H3,(H,21,22) |
| InChIKey | MRAPSBKVGFKVMY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|