C21H19FNO5S- — CID 7289909
6-[(2S)-2-(2-fluorophenyl)-4-hydroxy-5-oxo-3-(thiophene-2-carbonyl)-2H-pyrrol-1-yl]hexanoate (PubChem CID 7289909) has the molecular formula C21H19FNO5S- and a molecular weight of 416.45 g/mol. Its IUPAC name is 6-[(2S)-2-(2-fluorophenyl)-4-hydroxy-5-oxo-3-(thiophene-2-carbonyl)-2H-pyrrol-1-yl]hexanoate.
| Compound Name | 6-[(2S)-2-(2-fluorophenyl)-4-hydroxy-5-oxo-3-(thiophene-2-carbonyl)-2H-pyrrol-1-yl]hexanoate |
|---|---|
| PubChem CID | 7289909 |
| Molecular Formula | C21H19FNO5S- |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 6-[(2S)-2-(2-fluorophenyl)-4-hydroxy-5-oxo-3-(thiophene-2-carbonyl)-2H-pyrrol-1-yl]hexanoate |
| SMILES | O=C([O-])CCCCCN1C(=O)C(O)=C(C(=O)c2cccs2)[C@H]1c1ccccc1F |
| InChI | InChI=1S/C21H20FNO5S/c22-14-8-4-3-7-13(14)18-17(19(26)15-9-6-12-29-15)20(27)21(28)23(18)11-5-1-2-10-16(24)25/h3-4,6-9,12,18,27H,1-2,5,10-11H2,(H,24,25)/p-1/t18-/m1/s1 |
| InChIKey | VFKAPXIWWUWBPC-GOSISDBHSA-M |
| XLogP | 2.78 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|