C20H18N2O4 — CID 7289963
N-[(2S)-3-[(4-methoxyphenyl)methylimino]-1,4-dioxonaphthalen-2-yl]acetamide (PubChem CID 7289963) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is N-[(2S)-3-[(4-methoxyphenyl)methylimino]-1,4-dioxonaphthalen-2-yl]acetamide.
| Compound Name | N-[(2S)-3-[(4-methoxyphenyl)methylimino]-1,4-dioxonaphthalen-2-yl]acetamide |
|---|---|
| PubChem CID | 7289963 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | N-[(2S)-3-[(4-methoxyphenyl)methylimino]-1,4-dioxonaphthalen-2-yl]acetamide |
| SMILES | COc1ccc(C/N=C2\C(=O)c3ccccc3C(=O)[C@H]2NC(C)=O)cc1 |
| InChI | InChI=1S/C20H18N2O4/c1-12(23)22-18-17(21-11-13-7-9-14(26-2)10-8-13)19(24)15-5-3-4-6-16(15)20(18)25/h3-10,18H,11H2,1-2H3,(H,22,23)/b21-17-/t18-/m0/s1 |
| InChIKey | HYUNRTUTYZJDDZ-HGBKYHTQSA-N |
| XLogP | 2.22 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|