C16H19NO2 — CID 72906295
4-(4-phenylmethoxybutyl)-1H-pyridin-2-one (PubChem CID 72906295) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 4-(4-phenylmethoxybutyl)-1H-pyridin-2-one.
| Compound Name | 4-(4-phenylmethoxybutyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 72906295 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 4-(4-phenylmethoxybutyl)-1H-pyridin-2-one |
| SMILES | O=c1cc(CCCCOCc2ccccc2)cc[nH]1 |
| InChI | InChI=1S/C16H19NO2/c18-16-12-14(9-10-17-16)6-4-5-11-19-13-15-7-2-1-3-8-15/h1-3,7-10,12H,4-6,11,13H2,(H,17,18) |
| InChIKey | YYGFLMBGGISNSA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|