C17H25N3O4S — CID 72918439
3-[1-(4-methylpiperazin-1-yl)sulfonylpiperidin-3-yl]benzoic acid (PubChem CID 72918439) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is 3-[1-(4-methylpiperazin-1-yl)sulfonylpiperidin-3-yl]benzoic acid.
| Compound Name | 3-[1-(4-methylpiperazin-1-yl)sulfonylpiperidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 72918439 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 3-[1-(4-methylpiperazin-1-yl)sulfonylpiperidin-3-yl]benzoic acid |
| SMILES | CN1CCN(S(=O)(=O)N2CCCC(c3cccc(C(=O)O)c3)C2)CC1 |
| InChI | InChI=1S/C17H25N3O4S/c1-18-8-10-19(11-9-18)25(23,24)20-7-3-6-16(13-20)14-4-2-5-15(12-14)17(21)22/h2,4-5,12,16H,3,6-11,13H2,1H3,(H,21,22) |
| InChIKey | QZHKYFBDSFQQAM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |