C15H19NO4S — CID 97191593
3-[(3R)-1-cyclopropylsulfonylpiperidin-3-yl]benzoic acid (PubChem CID 97191593) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is 3-[(3R)-1-cyclopropylsulfonylpiperidin-3-yl]benzoic acid.
| Compound Name | 3-[(3R)-1-cyclopropylsulfonylpiperidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 97191593 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 3-[(3R)-1-cyclopropylsulfonylpiperidin-3-yl]benzoic acid |
| SMILES | O=C(O)c1cccc([C@H]2CCCN(S(=O)(=O)C3CC3)C2)c1 |
| InChI | InChI=1S/C15H19NO4S/c17-15(18)12-4-1-3-11(9-12)13-5-2-8-16(10-13)21(19,20)14-6-7-14/h1,3-4,9,13-14H,2,5-8,10H2,(H,17,18)/t13-/m0/s1 |
| InChIKey | OWIAZJSQGBGOEY-ZDUSSCGKSA-N |
| XLogP | 2.06 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |