C19H28N2O4S — CID 97187404
3-[(3R)-1-(4,4-dimethylpiperidin-1-yl)sulfonylpiperidin-3-yl]benzoic acid (PubChem CID 97187404) has the molecular formula C19H28N2O4S and a molecular weight of 380.51 g/mol. Its IUPAC name is 3-[(3R)-1-(4,4-dimethylpiperidin-1-yl)sulfonylpiperidin-3-yl]benzoic acid.
| Compound Name | 3-[(3R)-1-(4,4-dimethylpiperidin-1-yl)sulfonylpiperidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 97187404 |
| Molecular Formula | C19H28N2O4S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 3-[(3R)-1-(4,4-dimethylpiperidin-1-yl)sulfonylpiperidin-3-yl]benzoic acid |
| SMILES | CC1(C)CCN(S(=O)(=O)N2CCC[C@H](c3cccc(C(=O)O)c3)C2)CC1 |
| InChI | InChI=1S/C19H28N2O4S/c1-19(2)8-11-20(12-9-19)26(24,25)21-10-4-7-17(14-21)15-5-3-6-16(13-15)18(22)23/h3,5-6,13,17H,4,7-12,14H2,1-2H3,(H,22,23)/t17-/m0/s1 |
| InChIKey | LOMASRQRINGQJM-KRWDZBQOSA-N |
| XLogP | 2.93 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |