C19H32N4OS — CID 72921817
(2S)-3-cyclohexyl-2-[[1-(2-methylsulfanylpyrimidin-4-yl)piperidin-4-yl]amino]propan-1-ol (PubChem CID 72921817) has the molecular formula C19H32N4OS and a molecular weight of 364.56 g/mol. Its IUPAC name is (2S)-3-cyclohexyl-2-[[1-(2-methylsulfanylpyrimidin-4-yl)piperidin-4-yl]amino]propan-1-ol.
| Compound Name | (2S)-3-cyclohexyl-2-[[1-(2-methylsulfanylpyrimidin-4-yl)piperidin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 72921817 |
| Molecular Formula | C19H32N4OS |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | (2S)-3-cyclohexyl-2-[[1-(2-methylsulfanylpyrimidin-4-yl)piperidin-4-yl]amino]propan-1-ol |
| SMILES | CSc1nccc(N2CCC(N[C@H](CO)CC3CCCCC3)CC2)n1 |
| InChI | InChI=1S/C19H32N4OS/c1-25-19-20-10-7-18(22-19)23-11-8-16(9-12-23)21-17(14-24)13-15-5-3-2-4-6-15/h7,10,15-17,21,24H,2-6,8-9,11-14H2,1H3/t17-/m0/s1 |
| InChIKey | CNIAEDNOZGJRJG-KRWDZBQOSA-N |
| XLogP | 3.09 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |