C20H17ClN4O — CID 72926522
[3-(2-chlorophenyl)pyrrolidin-1-yl]-(2-pyridin-4-ylpyrimidin-5-yl)methanone (PubChem CID 72926522) has the molecular formula C20H17ClN4O and a molecular weight of 364.84 g/mol. Its IUPAC name is [3-(2-chlorophenyl)pyrrolidin-1-yl]-(2-pyridin-4-ylpyrimidin-5-yl)methanone.
| Compound Name | [3-(2-chlorophenyl)pyrrolidin-1-yl]-(2-pyridin-4-ylpyrimidin-5-yl)methanone |
|---|---|
| PubChem CID | 72926522 |
| Molecular Formula | C20H17ClN4O |
| Molecular Weight | 364.84 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | [3-(2-chlorophenyl)pyrrolidin-1-yl]-(2-pyridin-4-ylpyrimidin-5-yl)methanone |
| SMILES | O=C(c1cnc(-c2ccncc2)nc1)N1CCC(c2ccccc2Cl)C1 |
| InChI | InChI=1S/C20H17ClN4O/c21-18-4-2-1-3-17(18)15-7-10-25(13-15)20(26)16-11-23-19(24-12-16)14-5-8-22-9-6-14/h1-6,8-9,11-12,15H,7,10,13H2 |
| InChIKey | WZYWBFOGQIEJCP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.84 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |