C22H32N4O2 — CID 72927891
trans-(1S,3R)-3-N,3-N,1,2,2-pentamethyl-1-N-[2-(1-methylbenzimidazol-2-yl)ethyl]cyclopentane-1,3-dicarboxamide (PubChem CID 72927891) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is trans-(1S,3R)-3-N,3-N,1,2,2-pentamethyl-1-N-[2-(1-methylbenzimidazol-2-yl)ethyl]cyclopentane-1,3-dicarboxamide.
| Compound Name | trans-(1S,3R)-3-N,3-N,1,2,2-pentamethyl-1-N-[2-(1-methylbenzimidazol-2-yl)ethyl]cyclopentane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 72927891 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | trans-(1S,3R)-3-N,3-N,1,2,2-pentamethyl-1-N-[2-(1-methylbenzimidazol-2-yl)ethyl]cyclopentane-1,3-dicarboxamide |
| SMILES | CN(C)C(=O)[C@@H]1CC[C@](C)(C(=O)NCCc2nc3ccccc3n2C)C1(C)C |
| InChI | InChI=1S/C22H32N4O2/c1-21(2)15(19(27)25(4)5)11-13-22(21,3)20(28)23-14-12-18-24-16-9-7-8-10-17(16)26(18)6/h7-10,15H,11-14H2,1-6H3,(H,23,28)/t15-,22+/m0/s1 |
| InChIKey | MPBZRAMUEUPPTP-OYHNWAKOSA-N |
| XLogP | 2.76 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |