C14H19N3O4 — CID 72930183
1-[(3,4-dimethoxy-2-pyridinyl)methyl]-4-ethylpiperazine-2,3-dione (PubChem CID 72930183) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is 1-[(3,4-dimethoxy-2-pyridinyl)methyl]-4-ethylpiperazine-2,3-dione.
| Compound Name | 1-[(3,4-dimethoxy-2-pyridinyl)methyl]-4-ethylpiperazine-2,3-dione |
|---|---|
| PubChem CID | 72930183 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 1-[(3,4-dimethoxy-2-pyridinyl)methyl]-4-ethylpiperazine-2,3-dione |
| SMILES | CCN1CCN(Cc2nccc(OC)c2OC)C(=O)C1=O |
| InChI | InChI=1S/C14H19N3O4/c1-4-16-7-8-17(14(19)13(16)18)9-10-12(21-3)11(20-2)5-6-15-10/h5-6H,4,7-9H2,1-3H3 |
| InChIKey | INUPNYCUCIDYML-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|