C21H26N4O — CID 72931796
N-cyclopropyl-2,3-dimethyl-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]-1H-indole-7-carboxamide (PubChem CID 72931796) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is N-cyclopropyl-2,3-dimethyl-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]-1H-indole-7-carboxamide.
| Compound Name | N-cyclopropyl-2,3-dimethyl-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 72931796 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | N-cyclopropyl-2,3-dimethyl-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]-1H-indole-7-carboxamide |
| SMILES | Cc1nn(C)c(C)c1CN(C(=O)c1cccc2c(C)c(C)[nH]c12)C1CC1 |
| InChI | InChI=1S/C21H26N4O/c1-12-13(2)22-20-17(12)7-6-8-18(20)21(26)25(16-9-10-16)11-19-14(3)23-24(5)15(19)4/h6-8,16,22H,9-11H2,1-5H3 |
| InChIKey | NYYFDMZTKZDKLV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|