C25H30N2O2 — CID 42471181
N-cyclopropyl-2,3-dimethyl-N-[[3-(2-methylpropoxy)phenyl]methyl]-1H-indole-7-carboxamide (PubChem CID 42471181) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is N-cyclopropyl-2,3-dimethyl-N-[[3-(2-methylpropoxy)phenyl]methyl]-1H-indole-7-carboxamide.
| Compound Name | N-cyclopropyl-2,3-dimethyl-N-[[3-(2-methylpropoxy)phenyl]methyl]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 42471181 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | N-cyclopropyl-2,3-dimethyl-N-[[3-(2-methylpropoxy)phenyl]methyl]-1H-indole-7-carboxamide |
| SMILES | Cc1[nH]c2c(C(=O)N(Cc3cccc(OCC(C)C)c3)C3CC3)cccc2c1C |
| InChI | InChI=1S/C25H30N2O2/c1-16(2)15-29-21-8-5-7-19(13-21)14-27(20-11-12-20)25(28)23-10-6-9-22-17(3)18(4)26-24(22)23/h5-10,13,16,20,26H,11-12,14-15H2,1-4H3 |
| InChIKey | VLHRBCCQLUBWLX-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|