C14H18N2O — CID 72945608
(1R,2R,10R)-15-methyl-4,12-diazatetracyclo[8.5.0.02,13.04,9]pentadeca-6,8-dien-5-one (PubChem CID 72945608) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is (1R,2R,10R)-15-methyl-4,12-diazatetracyclo[8.5.0.02,13.04,9]pentadeca-6,8-dien-5-one.
| Compound Name | (1R,2R,10R)-15-methyl-4,12-diazatetracyclo[8.5.0.02,13.04,9]pentadeca-6,8-dien-5-one |
|---|---|
| PubChem CID | 72945608 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | (1R,2R,10R)-15-methyl-4,12-diazatetracyclo[8.5.0.02,13.04,9]pentadeca-6,8-dien-5-one |
| SMILES | CC1CC2NC[C@@H]3c4cccc(=O)n4C[C@H]2[C@@H]13 |
| InChI | InChI=1S/C14H18N2O/c1-8-5-11-10-7-16-12(3-2-4-13(16)17)9(6-15-11)14(8)10/h2-4,8-11,14-15H,5-7H2,1H3/t8?,9-,10-,11?,14+/m1/s1 |
| InChIKey | XJHYAVIQMMKYJG-CPUWVPSRSA-N |
| XLogP | 1.19 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |