C30H25FN4O2 — CID 72946275
4-[4-(4-fluorophenyl)-5-phenyl-1,2-oxazol-3-yl]-N-(4-morpholin-4-ylphenyl)pyridin-2-amine (PubChem CID 72946275) has the molecular formula C30H25FN4O2 and a molecular weight of 492.55 g/mol. Its IUPAC name is 4-[4-(4-fluorophenyl)-5-phenyl-1,2-oxazol-3-yl]-N-(4-morpholin-4-ylphenyl)pyridin-2-amine.
| Compound Name | 4-[4-(4-fluorophenyl)-5-phenyl-1,2-oxazol-3-yl]-N-(4-morpholin-4-ylphenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 72946275 |
| Molecular Formula | C30H25FN4O2 |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 4-[4-(4-fluorophenyl)-5-phenyl-1,2-oxazol-3-yl]-N-(4-morpholin-4-ylphenyl)pyridin-2-amine |
| SMILES | Fc1ccc(-c2c(-c3ccnc(Nc4ccc(N5CCOCC5)cc4)c3)noc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H25FN4O2/c31-24-8-6-21(7-9-24)28-29(34-37-30(28)22-4-2-1-3-5-22)23-14-15-32-27(20-23)33-25-10-12-26(13-11-25)35-16-18-36-19-17-35/h1-15,20H,16-19H2,(H,32,33) |
| InChIKey | JPHFWHGEUJYIJJ-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 63.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|