C17H36O3Si — CID 72946857
tert-butyl-[(E)-7-(2-ethoxyethoxy)hept-5-enoxy]-dimethylsilane (PubChem CID 72946857) has the molecular formula C17H36O3Si and a molecular weight of 316.56 g/mol. Its IUPAC name is tert-butyl-[(E)-7-(2-ethoxyethoxy)hept-5-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-7-(2-ethoxyethoxy)hept-5-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 72946857 |
| Molecular Formula | C17H36O3Si |
| Molecular Weight | 316.56 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | tert-butyl-[(E)-7-(2-ethoxyethoxy)hept-5-enoxy]-dimethylsilane |
| SMILES | CCOCCOC/C=C/CCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H36O3Si/c1-7-18-15-16-19-13-11-9-8-10-12-14-20-21(5,6)17(2,3)4/h9,11H,7-8,10,12-16H2,1-6H3/b11-9+ |
| InChIKey | DJXGPNKXTRZCHA-PKNBQFBNSA-N |
| XLogP | 4.79 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.56 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|