C31H30FNO3 — CID 72946949
2-[[(8S,9S,13S,14S)-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]oxy]-2-phenylacetic acid (PubChem CID 72946949) has the molecular formula C31H30FNO3 and a molecular weight of 483.58 g/mol. Its IUPAC name is 2-[[(8S,9S,13S,14S)-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]oxy]-2-phenylacetic acid.
| Compound Name | 2-[[(8S,9S,13S,14S)-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]oxy]-2-phenylacetic acid |
|---|---|
| PubChem CID | 72946949 |
| Molecular Formula | C31H30FNO3 |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 2-[[(8S,9S,13S,14S)-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]oxy]-2-phenylacetic acid |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OC(C(=O)O)c5ccccc5)cc4CC[C@H]3[C@@H]1CC=C2c1cncc(F)c1 |
| InChI | InChI=1S/C31H30FNO3/c1-31-14-13-25-24-10-8-23(36-29(30(34)35)19-5-3-2-4-6-19)16-20(24)7-9-26(25)28(31)12-11-27(31)21-15-22(32)18-33-17-21/h2-6,8,10-11,15-18,25-26,28-29H,7,9,12-14H2,1H3,(H,34,35)/t25-,26-,28+,29?,31-/m1/s1 |
| InChIKey | RGROVNGBTZURKL-DXAIVGAESA-N |
| XLogP | 6.97 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |