C28H21N5O4 — CID 72948495
1-(3,3-diphenylpropyl)-2-(5-nitrofuran-2-yl)-5H-imidazo[4,5-g]quinoxalin-6-one (PubChem CID 72948495) has the molecular formula C28H21N5O4 and a molecular weight of 491.51 g/mol. Its IUPAC name is 1-(3,3-diphenylpropyl)-2-(5-nitrofuran-2-yl)-5H-imidazo[4,5-g]quinoxalin-6-one.
| Compound Name | 1-(3,3-diphenylpropyl)-2-(5-nitrofuran-2-yl)-5H-imidazo[4,5-g]quinoxalin-6-one |
|---|---|
| PubChem CID | 72948495 |
| Molecular Formula | C28H21N5O4 |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 1-(3,3-diphenylpropyl)-2-(5-nitrofuran-2-yl)-5H-imidazo[4,5-g]quinoxalin-6-one |
| SMILES | O=c1cnc2cc3c(cc2[nH]1)nc(-c1ccc([N+](=O)[O-])o1)n3CCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H21N5O4/c34-26-17-29-21-16-24-23(15-22(21)30-26)31-28(25-11-12-27(37-25)33(35)36)32(24)14-13-20(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-12,15-17,20H,13-14H2,(H,30,34) |
| InChIKey | YENHRTZRWIZGKX-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|