C14H23N3O7S — CID 72950545
N-[2-[ethyl(methyl)amino]ethyl]-2-methoxy-5-methylsulfonylbenzamide;nitric acid (PubChem CID 72950545) has the molecular formula C14H23N3O7S and a molecular weight of 377.42 g/mol. Its IUPAC name is N-[2-[ethyl(methyl)amino]ethyl]-2-methoxy-5-methylsulfonylbenzamide;nitric acid.
| Compound Name | N-[2-[ethyl(methyl)amino]ethyl]-2-methoxy-5-methylsulfonylbenzamide;nitric acid |
|---|---|
| PubChem CID | 72950545 |
| Molecular Formula | C14H23N3O7S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | N-[2-[ethyl(methyl)amino]ethyl]-2-methoxy-5-methylsulfonylbenzamide;nitric acid |
| SMILES | CCN(C)CCNC(=O)c1cc(S(C)(=O)=O)ccc1OC.O=[N+]([O-])O |
| InChI | InChI=1S/C14H22N2O4S.HNO3/c1-5-16(2)9-8-15-14(17)12-10-11(21(4,18)19)6-7-13(12)20-3;2-1(3)4/h6-7,10H,5,8-9H2,1-4H3,(H,15,17);(H,2,3,4) |
| InChIKey | NJVLVLTZZBMRKO-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|