C19H20N4O5 — CID 7295772
N-[[(2R,5R)-2,5-dimethoxy-2H-furan-5-yl]methyl]-6-methyl-2-oxo-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide (PubChem CID 7295772) has the molecular formula C19H20N4O5 and a molecular weight of 384.39 g/mol. Its IUPAC name is N-[[(2R,5R)-2,5-dimethoxy-2H-furan-5-yl]methyl]-6-methyl-2-oxo-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide.
| Compound Name | N-[[(2R,5R)-2,5-dimethoxy-2H-furan-5-yl]methyl]-6-methyl-2-oxo-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide |
|---|---|
| PubChem CID | 7295772 |
| Molecular Formula | C19H20N4O5 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N-[[(2R,5R)-2,5-dimethoxy-2H-furan-5-yl]methyl]-6-methyl-2-oxo-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide |
| SMILES | CO[C@H]1C=C[C@@](CNC(=O)c2cc3c(=O)n4ccccc4nc3n2C)(OC)O1 |
| InChI | InChI=1S/C19H20N4O5/c1-22-13(17(24)20-11-19(27-3)8-7-15(26-2)28-19)10-12-16(22)21-14-6-4-5-9-23(14)18(12)25/h4-10,15H,11H2,1-3H3,(H,20,24)/t15-,19-/m1/s1 |
| InChIKey | YGNLNMKHYXKLAN-DNVCBOLYSA-N |
| XLogP | 0.82 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|