C24H31FN4O3 — CID 72983983
N-(5-fluoro-2-pyridinyl)-1-[2-[(phenylmethoxyamino)methyl]hexanoyl]pyrrolidine-2-carboxamide (PubChem CID 72983983) has the molecular formula C24H31FN4O3 and a molecular weight of 442.54 g/mol. Its IUPAC name is N-(5-fluoro-2-pyridinyl)-1-[2-[(phenylmethoxyamino)methyl]hexanoyl]pyrrolidine-2-carboxamide.
| Compound Name | N-(5-fluoro-2-pyridinyl)-1-[2-[(phenylmethoxyamino)methyl]hexanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 72983983 |
| Molecular Formula | C24H31FN4O3 |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | N-(5-fluoro-2-pyridinyl)-1-[2-[(phenylmethoxyamino)methyl]hexanoyl]pyrrolidine-2-carboxamide |
| SMILES | CCCCC(CNOCc1ccccc1)C(=O)N1CCCC1C(=O)Nc1ccc(F)cn1 |
| InChI | InChI=1S/C24H31FN4O3/c1-2-3-10-19(15-27-32-17-18-8-5-4-6-9-18)24(31)29-14-7-11-21(29)23(30)28-22-13-12-20(25)16-26-22/h4-6,8-9,12-13,16,19,21,27H,2-3,7,10-11,14-15,17H2,1H3,(H,26,28,30) |
| InChIKey | ZVVYHZSHTYFPAB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|