C27H34O5S2 — CID 73011657
bis[3-cyclohexyl-5-(1,3-dioxolan-2-yl)thiophen-2-yl]methanone (PubChem CID 73011657) has the molecular formula C27H34O5S2 and a molecular weight of 502.70 g/mol. Its IUPAC name is bis[3-cyclohexyl-5-(1,3-dioxolan-2-yl)thiophen-2-yl]methanone.
| Compound Name | bis[3-cyclohexyl-5-(1,3-dioxolan-2-yl)thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 73011657 |
| Molecular Formula | C27H34O5S2 |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | bis[3-cyclohexyl-5-(1,3-dioxolan-2-yl)thiophen-2-yl]methanone |
| SMILES | O=C(c1sc(C2OCCO2)cc1C1CCCCC1)c1sc(C2OCCO2)cc1C1CCCCC1 |
| InChI | InChI=1S/C27H34O5S2/c28-23(24-19(17-7-3-1-4-8-17)15-21(33-24)26-29-11-12-30-26)25-20(18-9-5-2-6-10-18)16-22(34-25)27-31-13-14-32-27/h15-18,26-27H,1-14H2 |
| InChIKey | AMJSBDAHLWXRAJ-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |