About 7-benzyl-1-oxa-7-azaspiro[4.4]nonane-4,6,8-trione
7-benzyl-1-oxa-7-azaspiro[4.4]nonane-4,6,8-trione (PubChem CID 73013667) has the molecular formula C14H13NO4
and a molecular weight of 259.26 g/mol. Its IUPAC name is 7-benzyl-1-oxa-7-azaspiro[4.4]nonane-4,6,8-trione.
Molecular Properties
| Compound Name | 7-benzyl-1-oxa-7-azaspiro[4.4]nonane-4,6,8-trione |
| PubChem CID | 73013667 |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 7-benzyl-1-oxa-7-azaspiro[4.4]nonane-4,6,8-trione |
| SMILES | O=C1CC2(OCCC2=O)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C14H13NO4/c16-11-6-7-19-14(11)8-12(17)15(13(14)18)9-10-4-2-1-3-5-10/h1-5H,6-9H2 |
| InChIKey | KANSJQXUGYWTEZ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 7-benzyl-1-oxa-7-azaspiro[4.4]nonane-4,6,8-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-benzyl-1-oxa-7-azaspiro[4.4]nonane-4,6,8-trione?
The IUPAC name of 7-benzyl-1-oxa-7-azaspiro[4.4]nonane-4,6,8-trione (CID 73013667) is 7-benzyl-1-oxa-7-azaspiro[4.4]nonane-4,6,8-trione.
What is the SMILES notation for 7-benzyl-1-oxa-7-azaspiro[4.4]nonane-4,6,8-trione?
The canonical SMILES for 7-benzyl-1-oxa-7-azaspiro[4.4]nonane-4,6,8-trione is O=C1CC2(OCCC2=O)C(=O)N1Cc1ccccc1.
What is the InChIKey of 7-benzyl-1-oxa-7-azaspiro[4.4]nonane-4,6,8-trione?
The InChIKey is KANSJQXUGYWTEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO4/c16-11-6-7-19-14(11)8-12(17)15(13(14)18)9-10-4-2-1-3-5-10/h1-5H,6-9H2.
What are the key properties of 7-benzyl-1-oxa-7-azaspiro[4.4]nonane-4,6,8-trione?
7-benzyl-1-oxa-7-azaspiro[4.4]nonane-4,6,8-trione has a molecular weight of 259.26 g/mol, XLogP of 0.67, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-benzyl-1-oxa-7-azaspiro[4.4]nonane-4,6,8-trione is sourced from PubChem (CID 73013667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).