C14H9ClF3N3O2 — CID 7303450
4-chloro-N-[(3R)-4-cyano-5-methyl-2-oxo-3-(trifluoromethyl)-1H-pyrrol-3-yl]benzamide (PubChem CID 7303450) has the molecular formula C14H9ClF3N3O2 and a molecular weight of 343.69 g/mol. Its IUPAC name is 4-chloro-N-[(3R)-4-cyano-5-methyl-2-oxo-3-(trifluoromethyl)-1H-pyrrol-3-yl]benzamide.
| Compound Name | 4-chloro-N-[(3R)-4-cyano-5-methyl-2-oxo-3-(trifluoromethyl)-1H-pyrrol-3-yl]benzamide |
|---|---|
| PubChem CID | 7303450 |
| Molecular Formula | C14H9ClF3N3O2 |
| Molecular Weight | 343.69 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 4-chloro-N-[(3R)-4-cyano-5-methyl-2-oxo-3-(trifluoromethyl)-1H-pyrrol-3-yl]benzamide |
| SMILES | CC1=C(C#N)[C@](NC(=O)c2ccc(Cl)cc2)(C(F)(F)F)C(=O)N1 |
| InChI | InChI=1S/C14H9ClF3N3O2/c1-7-10(6-19)13(12(23)20-7,14(16,17)18)21-11(22)8-2-4-9(15)5-3-8/h2-5H,1H3,(H,20,23)(H,21,22)/t13-/m1/s1 |
| InChIKey | LPUAUDYMPLRLLO-CYBMUJFWSA-N |
| XLogP | 2.30 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.69 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |