C12H8F3N3O2S — CID 7107011
N-[(3S)-4-cyano-5-methyl-2-oxo-3-(trifluoromethyl)-1H-pyrrol-3-yl]thiophene-2-carboxamide (PubChem CID 7107011) has the molecular formula C12H8F3N3O2S and a molecular weight of 315.28 g/mol. Its IUPAC name is N-[(3S)-4-cyano-5-methyl-2-oxo-3-(trifluoromethyl)-1H-pyrrol-3-yl]thiophene-2-carboxamide.
| Compound Name | N-[(3S)-4-cyano-5-methyl-2-oxo-3-(trifluoromethyl)-1H-pyrrol-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 7107011 |
| Molecular Formula | C12H8F3N3O2S |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | N-[(3S)-4-cyano-5-methyl-2-oxo-3-(trifluoromethyl)-1H-pyrrol-3-yl]thiophene-2-carboxamide |
| SMILES | CC1=C(C#N)[C@@](NC(=O)c2cccs2)(C(F)(F)F)C(=O)N1 |
| InChI | InChI=1S/C12H8F3N3O2S/c1-6-7(5-16)11(10(20)17-6,12(13,14)15)18-9(19)8-3-2-4-21-8/h2-4H,1H3,(H,17,20)(H,18,19)/t11-/m0/s1 |
| InChIKey | BGOWYMDCARNGRM-NSHDSACASA-N |
| XLogP | 1.71 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |