C12H14FNOS — CID 163869327
N-(2-fluoro-1-methylcyclohex-3-en-1-yl)thiophene-2-carboxamide (PubChem CID 163869327) has the molecular formula C12H14FNOS and a molecular weight of 239.31 g/mol. Its IUPAC name is N-(2-fluoro-1-methylcyclohex-3-en-1-yl)thiophene-2-carboxamide.
| Compound Name | N-(2-fluoro-1-methylcyclohex-3-en-1-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 163869327 |
| Molecular Formula | C12H14FNOS |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | N-(2-fluoro-1-methylcyclohex-3-en-1-yl)thiophene-2-carboxamide |
| SMILES | CC1(NC(=O)c2cccs2)CCC=CC1F |
| InChI | InChI=1S/C12H14FNOS/c1-12(7-3-2-6-10(12)13)14-11(15)9-5-4-8-16-9/h2,4-6,8,10H,3,7H2,1H3,(H,14,15) |
| InChIKey | PJKKBQIHLKHYBD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|