C7H13NO2S — CID 73042600
3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]thiazine-7,8-diol (PubChem CID 73042600) has the molecular formula C7H13NO2S and a molecular weight of 175.25 g/mol. Its IUPAC name is 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]thiazine-7,8-diol.
| Compound Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]thiazine-7,8-diol |
|---|---|
| PubChem CID | 73042600 |
| Molecular Formula | C7H13NO2S |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]thiazine-7,8-diol |
| SMILES | OC1CN2CCSCC2C1O |
| InChI | InChI=1S/C7H13NO2S/c9-6-3-8-1-2-11-4-5(8)7(6)10/h5-7,9-10H,1-4H2 |
| InChIKey | UGCAIGYNMYZSKU-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |