C20H18N5O4- — CID 7304531
3-[2,5-dimethyl-3-[(Z)-[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]pyrrol-1-yl]-2-methylbenzoate (PubChem CID 7304531) has the molecular formula C20H18N5O4- and a molecular weight of 392.40 g/mol. Its IUPAC name is 3-[2,5-dimethyl-3-[(Z)-[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]pyrrol-1-yl]-2-methylbenzoate.
| Compound Name | 3-[2,5-dimethyl-3-[(Z)-[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]pyrrol-1-yl]-2-methylbenzoate |
|---|---|
| PubChem CID | 7304531 |
| Molecular Formula | C20H18N5O4- |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 3-[2,5-dimethyl-3-[(Z)-[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]pyrrol-1-yl]-2-methylbenzoate |
| SMILES | Cc1c(C(=O)[O-])cccc1-n1c(C)cc(/C=N\Nc2ccc([N+](=O)[O-])cn2)c1C |
| InChI | InChI=1S/C20H19N5O4/c1-12-9-15(10-22-23-19-8-7-16(11-21-19)25(28)29)14(3)24(12)18-6-4-5-17(13(18)2)20(26)27/h4-11H,1-3H3,(H,21,23)(H,26,27)/p-1/b22-10- |
| InChIKey | SMYYOGPOSZLIIW-YVNNLAQVSA-M |
| XLogP | 2.52 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|