C9H9N3O2 — CID 73051105
N-pyridin-3-yl-4,5-dihydro-1,2-oxazole-3-carboxamide (PubChem CID 73051105) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is N-pyridin-3-yl-4,5-dihydro-1,2-oxazole-3-carboxamide.
| Compound Name | N-pyridin-3-yl-4,5-dihydro-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 73051105 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | N-pyridin-3-yl-4,5-dihydro-1,2-oxazole-3-carboxamide |
| SMILES | O=C(Nc1cccnc1)C1=NOCC1 |
| InChI | InChI=1S/C9H9N3O2/c13-9(8-3-5-14-12-8)11-7-2-1-4-10-6-7/h1-2,4,6H,3,5H2,(H,11,13) |
| InChIKey | VYXWEQNTZOAYDV-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |