C22H22F2O2S — CID 73056727
5-[difluoro(phenylsulfanyl)methyl]-5-[(E)-4-(4-methylphenyl)but-3-enyl]oxolan-2-one (PubChem CID 73056727) has the molecular formula C22H22F2O2S and a molecular weight of 388.48 g/mol. Its IUPAC name is 5-[difluoro(phenylsulfanyl)methyl]-5-[(E)-4-(4-methylphenyl)but-3-enyl]oxolan-2-one.
| Compound Name | 5-[difluoro(phenylsulfanyl)methyl]-5-[(E)-4-(4-methylphenyl)but-3-enyl]oxolan-2-one |
|---|---|
| PubChem CID | 73056727 |
| Molecular Formula | C22H22F2O2S |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 5-[difluoro(phenylsulfanyl)methyl]-5-[(E)-4-(4-methylphenyl)but-3-enyl]oxolan-2-one |
| SMILES | Cc1ccc(/C=C/CCC2(C(F)(F)Sc3ccccc3)CCC(=O)O2)cc1 |
| InChI | InChI=1S/C22H22F2O2S/c1-17-10-12-18(13-11-17)7-5-6-15-21(16-14-20(25)26-21)22(23,24)27-19-8-3-2-4-9-19/h2-5,7-13H,6,14-16H2,1H3/b7-5+ |
| InChIKey | NZBPJNFULPCDRI-FNORWQNLSA-N |
| XLogP | 6.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |