C27H24F2O3S — CID 73057943
3-[difluoro(phenylsulfanyl)methyl]-3-[(E)-5-(3-methoxyphenyl)pent-4-enyl]-2-benzofuran-1-one (PubChem CID 73057943) has the molecular formula C27H24F2O3S and a molecular weight of 466.55 g/mol. Its IUPAC name is 3-[difluoro(phenylsulfanyl)methyl]-3-[(E)-5-(3-methoxyphenyl)pent-4-enyl]-2-benzofuran-1-one.
| Compound Name | 3-[difluoro(phenylsulfanyl)methyl]-3-[(E)-5-(3-methoxyphenyl)pent-4-enyl]-2-benzofuran-1-one |
|---|---|
| PubChem CID | 73057943 |
| Molecular Formula | C27H24F2O3S |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 3-[difluoro(phenylsulfanyl)methyl]-3-[(E)-5-(3-methoxyphenyl)pent-4-enyl]-2-benzofuran-1-one |
| SMILES | COc1cccc(/C=C/CCCC2(C(F)(F)Sc3ccccc3)OC(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C27H24F2O3S/c1-31-21-13-10-12-20(19-21)11-4-3-9-18-26(24-17-8-7-16-23(24)25(30)32-26)27(28,29)33-22-14-5-2-6-15-22/h2,4-8,10-17,19H,3,9,18H2,1H3/b11-4+ |
| InChIKey | FBBVCBOWKRWDCJ-NYYWCZLTSA-N |
| XLogP | 7.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|