C21H18O4S — CID 122182545
3-(4-methoxyphenyl)sulfanyl-2,2-dimethyl-3H-benzo[g][1]benzofuran-4,5-dione (PubChem CID 122182545) has the molecular formula C21H18O4S and a molecular weight of 366.44 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)sulfanyl-2,2-dimethyl-3H-benzo[g][1]benzofuran-4,5-dione.
| Compound Name | 3-(4-methoxyphenyl)sulfanyl-2,2-dimethyl-3H-benzo[g][1]benzofuran-4,5-dione |
|---|---|
| PubChem CID | 122182545 |
| Molecular Formula | C21H18O4S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 3-(4-methoxyphenyl)sulfanyl-2,2-dimethyl-3H-benzo[g][1]benzofuran-4,5-dione |
| SMILES | COc1ccc(SC2C3=C(OC2(C)C)c2ccccc2C(=O)C3=O)cc1 |
| InChI | InChI=1S/C21H18O4S/c1-21(2)20(26-13-10-8-12(24-3)9-11-13)16-18(23)17(22)14-6-4-5-7-15(14)19(16)25-21/h4-11,20H,1-3H3 |
| InChIKey | WZMYJVIMQIZTLA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|