C31H39N3O2 — CID 73061113
1-[4-[2-(benzylamino)ethyl]cyclohexyl]-3-(1-hydroxy-1,1-diphenylpropan-2-yl)urea (PubChem CID 73061113) has the molecular formula C31H39N3O2 and a molecular weight of 485.67 g/mol. Its IUPAC name is 1-[4-[2-(benzylamino)ethyl]cyclohexyl]-3-(1-hydroxy-1,1-diphenylpropan-2-yl)urea.
| Compound Name | 1-[4-[2-(benzylamino)ethyl]cyclohexyl]-3-(1-hydroxy-1,1-diphenylpropan-2-yl)urea |
|---|---|
| PubChem CID | 73061113 |
| Molecular Formula | C31H39N3O2 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | 1-[4-[2-(benzylamino)ethyl]cyclohexyl]-3-(1-hydroxy-1,1-diphenylpropan-2-yl)urea |
| SMILES | CC(NC(=O)NC1CCC(CCNCc2ccccc2)CC1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H39N3O2/c1-24(31(36,27-13-7-3-8-14-27)28-15-9-4-10-16-28)33-30(35)34-29-19-17-25(18-20-29)21-22-32-23-26-11-5-2-6-12-26/h2-16,24-25,29,32,36H,17-23H2,1H3,(H2,33,34,35) |
| InChIKey | GSCNBENOLHMLKR-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|