C36H43N3O2 — CID 89145990
1-[4-[2-[(2R,6R)-3-azatetracyclo[5.4.0.02,4.04,6]undeca-1(11),7,9-trien-3-yl]ethyl]cyclohexyl]-3-[(2R)-1-hydroxy-3-methyl-1,1-diphenylbutan-2-yl]urea (PubChem CID 89145990) has the molecular formula C36H43N3O2 and a molecular weight of 549.76 g/mol. Its IUPAC name is 1-[4-[2-[(2R,6R)-3-azatetracyclo[5.4.0.02,4.04,6]undeca-1(11),7,9-trien-3-yl]ethyl]cyclohexyl]-3-[(2R)-1-hydroxy-3-methyl-1,1-diphenylbutan-2-yl]urea.
| Compound Name | 1-[4-[2-[(2R,6R)-3-azatetracyclo[5.4.0.02,4.04,6]undeca-1(11),7,9-trien-3-yl]ethyl]cyclohexyl]-3-[(2R)-1-hydroxy-3-methyl-1,1-diphenylbutan-2-yl]urea |
|---|---|
| PubChem CID | 89145990 |
| Molecular Formula | C36H43N3O2 |
| Molecular Weight | 549.76 g/mol |
| Exact Mass | 549.34 |
| IUPAC Name | 1-[4-[2-[(2R,6R)-3-azatetracyclo[5.4.0.02,4.04,6]undeca-1(11),7,9-trien-3-yl]ethyl]cyclohexyl]-3-[(2R)-1-hydroxy-3-methyl-1,1-diphenylbutan-2-yl]urea |
| SMILES | CC(C)[C@@H](NC(=O)NC1CCC(CCN2[C@@H]3c4ccccc4[C@H]4CC432)CC1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H43N3O2/c1-24(2)32(36(41,26-11-5-3-6-12-26)27-13-7-4-8-14-27)38-34(40)37-28-19-17-25(18-20-28)21-22-39-33-30-16-10-9-15-29(30)31-23-35(31,33)39/h3-16,24-25,28,31-33,41H,17-23H2,1-2H3,(H2,37,38,40)/t25?,28?,31-,32-,33-,35?,39?/m1/s1 |
| InChIKey | GYYXEMYDAFQXOA-NHMVWRICSA-N |
| XLogP | 6.49 |
| TPSA | 64.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.76 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|