C23H27N4O+ — CID 7306334
2-(4-ethylphenyl)-N-(4-methylpiperazin-4-ium-1-yl)quinoline-4-carboxamide (PubChem CID 7306334) has the molecular formula C23H27N4O+ and a molecular weight of 375.50 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-N-(4-methylpiperazin-4-ium-1-yl)quinoline-4-carboxamide.
| Compound Name | 2-(4-ethylphenyl)-N-(4-methylpiperazin-4-ium-1-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 7306334 |
| Molecular Formula | C23H27N4O+ |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 2-(4-ethylphenyl)-N-(4-methylpiperazin-4-ium-1-yl)quinoline-4-carboxamide |
| SMILES | CCc1ccc(-c2cc(C(=O)NN3CC[NH+](C)CC3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C23H26N4O/c1-3-17-8-10-18(11-9-17)22-16-20(19-6-4-5-7-21(19)24-22)23(28)25-27-14-12-26(2)13-15-27/h4-11,16H,3,12-15H2,1-2H3,(H,25,28)/p+1 |
| InChIKey | BXJXHXNSQWRVHT-UHFFFAOYSA-O |
| XLogP | 1.94 |
| TPSA | 49.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |