C18H21N5O2 — CID 7306477
4-[[(4S,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-4-yl]methylamino]-5-nitrobenzene-1,2-dicarbonitrile (PubChem CID 7306477) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is 4-[[(4S,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-4-yl]methylamino]-5-nitrobenzene-1,2-dicarbonitrile.
| Compound Name | 4-[[(4S,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-4-yl]methylamino]-5-nitrobenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 7306477 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 4-[[(4S,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-4-yl]methylamino]-5-nitrobenzene-1,2-dicarbonitrile |
| SMILES | N#Cc1cc(NC[C@@H]2CCC[C@@H]3CCCCN32)c([N+](=O)[O-])cc1C#N |
| InChI | InChI=1S/C18H21N5O2/c19-10-13-8-17(18(23(24)25)9-14(13)11-20)21-12-16-6-3-5-15-4-1-2-7-22(15)16/h8-9,15-16,21H,1-7,12H2/t15-,16-/m0/s1 |
| InChIKey | TWZKYQDKKNQNIW-HOTGVXAUSA-N |
| XLogP | 3.16 |
| TPSA | 105.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|