C9H7Cl2NO2 — CID 73069165
3-(2,4-dichlorophenyl)-N-hydroxyprop-2-enamide (PubChem CID 73069165) has the molecular formula C9H7Cl2NO2 and a molecular weight of 232.07 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-N-hydroxyprop-2-enamide.
| Compound Name | 3-(2,4-dichlorophenyl)-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 73069165 |
| Molecular Formula | C9H7Cl2NO2 |
| Molecular Weight | 232.07 g/mol |
| Exact Mass | 230.99 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-N-hydroxyprop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)cc1Cl)NO |
| InChI | InChI=1S/C9H7Cl2NO2/c10-7-3-1-6(8(11)5-7)2-4-9(13)12-14/h1-5,14H,(H,12,13) |
| InChIKey | LHTLDFWBUPYUDR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.07 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|