C26H28O6S — CID 73078458
[3-(benzenesulfonyl)-1,4-bis(phenylmethoxy)butan-2-yl] acetate (PubChem CID 73078458) has the molecular formula C26H28O6S and a molecular weight of 468.57 g/mol. Its IUPAC name is [3-(benzenesulfonyl)-1,4-bis(phenylmethoxy)butan-2-yl] acetate.
| Compound Name | [3-(benzenesulfonyl)-1,4-bis(phenylmethoxy)butan-2-yl] acetate |
|---|---|
| PubChem CID | 73078458 |
| Molecular Formula | C26H28O6S |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | [3-(benzenesulfonyl)-1,4-bis(phenylmethoxy)butan-2-yl] acetate |
| SMILES | CC(=O)OC(COCc1ccccc1)C(COCc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H28O6S/c1-21(27)32-25(19-30-17-22-11-5-2-6-12-22)26(20-31-18-23-13-7-3-8-14-23)33(28,29)24-15-9-4-10-16-24/h2-16,25-26H,17-20H2,1H3 |
| InChIKey | QTTTYKIGRWUZQP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |