C12H18N2O4 — CID 73080243
5,12-dimethyl-3,7,10,14-tetraoxa-15,16-diazapentacyclo[7.5.1.12,5.012,15.08,16]hexadecane (PubChem CID 73080243) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 5,12-dimethyl-3,7,10,14-tetraoxa-15,16-diazapentacyclo[7.5.1.12,5.012,15.08,16]hexadecane.
| Compound Name | 5,12-dimethyl-3,7,10,14-tetraoxa-15,16-diazapentacyclo[7.5.1.12,5.012,15.08,16]hexadecane |
|---|---|
| PubChem CID | 73080243 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 5,12-dimethyl-3,7,10,14-tetraoxa-15,16-diazapentacyclo[7.5.1.12,5.012,15.08,16]hexadecane |
| SMILES | CC12COC3C4OCC5(C)COC(C(OC1)N32)N45 |
| InChI | InChI=1S/C12H18N2O4/c1-11-3-15-7-9-14-10(8(13(7)11)16-4-11)18-6-12(14,2)5-17-9/h7-10H,3-6H2,1-2H3 |
| InChIKey | GFPYVUSCUJSIQA-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |