C34H51NO2 — CID 69229006
3,5-bis[3-(4-tert-butylphenyl)butyl]-7a-methyl-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazole (PubChem CID 69229006) has the molecular formula C34H51NO2 and a molecular weight of 505.79 g/mol. Its IUPAC name is 3,5-bis[3-(4-tert-butylphenyl)butyl]-7a-methyl-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazole.
| Compound Name | 3,5-bis[3-(4-tert-butylphenyl)butyl]-7a-methyl-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazole |
|---|---|
| PubChem CID | 69229006 |
| Molecular Formula | C34H51NO2 |
| Molecular Weight | 505.79 g/mol |
| Exact Mass | 505.39 |
| IUPAC Name | 3,5-bis[3-(4-tert-butylphenyl)butyl]-7a-methyl-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazole |
| SMILES | CC(CCC1OCC2(C)COC(CCC(C)c3ccc(C(C)(C)C)cc3)N12)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C34H51NO2/c1-24(26-12-16-28(17-13-26)32(3,4)5)10-20-30-35-31(37-23-34(35,9)22-36-30)21-11-25(2)27-14-18-29(19-15-27)33(6,7)8/h12-19,24-25,30-31H,10-11,20-23H2,1-9H3 |
| InChIKey | KHQAOCFBABSSJR-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.79 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |