C17H18N4 — CID 7308076
(7aR)-5-iminospiro[1,2,6,7a-tetrahydroindene-7,1'-cyclohexane]-4,4,6-tricarbonitrile (PubChem CID 7308076) has the molecular formula C17H18N4 and a molecular weight of 278.36 g/mol. Its IUPAC name is (7aR)-5-iminospiro[1,2,6,7a-tetrahydroindene-7,1'-cyclohexane]-4,4,6-tricarbonitrile.
| Compound Name | (7aR)-5-iminospiro[1,2,6,7a-tetrahydroindene-7,1'-cyclohexane]-4,4,6-tricarbonitrile |
|---|---|
| PubChem CID | 7308076 |
| Molecular Formula | C17H18N4 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (7aR)-5-iminospiro[1,2,6,7a-tetrahydroindene-7,1'-cyclohexane]-4,4,6-tricarbonitrile |
| SMILES | [H]/N=C1\C(C#N)C2(CCCCC2)[C@H]2CCC=C2C1(C#N)C#N |
| InChI | InChI=1S/C17H18N4/c18-9-14-15(21)17(10-19,11-20)13-6-4-5-12(13)16(14)7-2-1-3-8-16/h6,12,14,21H,1-5,7-8H2/b21-15+/t12-,14?/m0/s1 |
| InChIKey | VQZZGTJITQIXOW-MFBMWOPPSA-N |
| XLogP | 3.48 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|